C12H18ClN3O2S — CID 119401548
N-methyl-N-(2-oxo-2-piperazin-1-ylethyl)thiophene-3-carboxamide;hydrochloride (PubChem CID 119401548) has the molecular formula C12H18ClN3O2S and a molecular weight of 303.81 g/mol. Its IUPAC name is N-methyl-N-(2-oxo-2-piperazin-1-ylethyl)thiophene-3-carboxamide;hydrochloride.
| Compound Name | N-methyl-N-(2-oxo-2-piperazin-1-ylethyl)thiophene-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119401548 |
| Molecular Formula | C12H18ClN3O2S |
| Molecular Weight | 303.81 g/mol |
| Exact Mass | 303.08 |
| IUPAC Name | N-methyl-N-(2-oxo-2-piperazin-1-ylethyl)thiophene-3-carboxamide;hydrochloride |
| SMILES | CN(CC(=O)N1CCNCC1)C(=O)c1ccsc1.Cl |
| InChI | InChI=1S/C12H17N3O2S.ClH/c1-14(12(17)10-2-7-18-9-10)8-11(16)15-5-3-13-4-6-15;/h2,7,9,13H,3-6,8H2,1H3;1H |
| InChIKey | KEBGNGNHRRBFKD-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.81 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |