C12H17N3O2S — CID 119402669
N-(3-oxo-3-piperazin-1-ylpropyl)thiophene-3-carboxamide (PubChem CID 119402669) has the molecular formula C12H17N3O2S and a molecular weight of 267.35 g/mol. Its IUPAC name is N-(3-oxo-3-piperazin-1-ylpropyl)thiophene-3-carboxamide.
| Compound Name | N-(3-oxo-3-piperazin-1-ylpropyl)thiophene-3-carboxamide |
|---|---|
| PubChem CID | 119402669 |
| Molecular Formula | C12H17N3O2S |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | N-(3-oxo-3-piperazin-1-ylpropyl)thiophene-3-carboxamide |
| SMILES | O=C(NCCC(=O)N1CCNCC1)c1ccsc1 |
| InChI | InChI=1S/C12H17N3O2S/c16-11(15-6-4-13-5-7-15)1-3-14-12(17)10-2-8-18-9-10/h2,8-9,13H,1,3-7H2,(H,14,17) |
| InChIKey | ARMGZFNYHDZNBC-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |