C21H26ClN3O3 — CID 119454800
N-methyl-N-(2-oxo-2-piperazin-1-ylethyl)-3-phenylmethoxybenzamide;hydrochloride (PubChem CID 119454800) has the molecular formula C21H26ClN3O3 and a molecular weight of 403.91 g/mol. Its IUPAC name is N-methyl-N-(2-oxo-2-piperazin-1-ylethyl)-3-phenylmethoxybenzamide;hydrochloride.
| Compound Name | N-methyl-N-(2-oxo-2-piperazin-1-ylethyl)-3-phenylmethoxybenzamide;hydrochloride |
|---|---|
| PubChem CID | 119454800 |
| Molecular Formula | C21H26ClN3O3 |
| Molecular Weight | 403.91 g/mol |
| Exact Mass | 403.17 |
| IUPAC Name | N-methyl-N-(2-oxo-2-piperazin-1-ylethyl)-3-phenylmethoxybenzamide;hydrochloride |
| SMILES | CN(CC(=O)N1CCNCC1)C(=O)c1cccc(OCc2ccccc2)c1.Cl |
| InChI | InChI=1S/C21H25N3O3.ClH/c1-23(15-20(25)24-12-10-22-11-13-24)21(26)18-8-5-9-19(14-18)27-16-17-6-3-2-4-7-17;/h2-9,14,22H,10-13,15-16H2,1H3;1H |
| InChIKey | SSODQUCOFGTTAX-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.91 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |