C24H32N4O3 — CID 20934294
3-(dimethylamino)-N-[(3-ethoxyphenyl)methyl]-N-(2-oxo-2-piperazin-1-ylethyl)benzamide (PubChem CID 20934294) has the molecular formula C24H32N4O3 and a molecular weight of 424.55 g/mol. Its IUPAC name is 3-(dimethylamino)-N-[(3-ethoxyphenyl)methyl]-N-(2-oxo-2-piperazin-1-ylethyl)benzamide.
| Compound Name | 3-(dimethylamino)-N-[(3-ethoxyphenyl)methyl]-N-(2-oxo-2-piperazin-1-ylethyl)benzamide |
|---|---|
| PubChem CID | 20934294 |
| Molecular Formula | C24H32N4O3 |
| Molecular Weight | 424.55 g/mol |
| Exact Mass | 424.25 |
| IUPAC Name | 3-(dimethylamino)-N-[(3-ethoxyphenyl)methyl]-N-(2-oxo-2-piperazin-1-ylethyl)benzamide |
| SMILES | CCOc1cccc(CN(CC(=O)N2CCNCC2)C(=O)c2cccc(N(C)C)c2)c1 |
| InChI | InChI=1S/C24H32N4O3/c1-4-31-22-10-5-7-19(15-22)17-28(18-23(29)27-13-11-25-12-14-27)24(30)20-8-6-9-21(16-20)26(2)3/h5-10,15-16,25H,4,11-14,17-18H2,1-3H3 |
| InChIKey | ICCBKJGKAWMLPF-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.55 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |