C24H30N4O4 — CID 46333123
4-acetamido-N-[(3-ethoxyphenyl)methyl]-N-(2-oxo-2-piperazin-1-ylethyl)benzamide (PubChem CID 46333123) has the molecular formula C24H30N4O4 and a molecular weight of 438.53 g/mol. Its IUPAC name is 4-acetamido-N-[(3-ethoxyphenyl)methyl]-N-(2-oxo-2-piperazin-1-ylethyl)benzamide.
| Compound Name | 4-acetamido-N-[(3-ethoxyphenyl)methyl]-N-(2-oxo-2-piperazin-1-ylethyl)benzamide |
|---|---|
| PubChem CID | 46333123 |
| Molecular Formula | C24H30N4O4 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.23 |
| IUPAC Name | 4-acetamido-N-[(3-ethoxyphenyl)methyl]-N-(2-oxo-2-piperazin-1-ylethyl)benzamide |
| SMILES | CCOc1cccc(CN(CC(=O)N2CCNCC2)C(=O)c2ccc(NC(C)=O)cc2)c1 |
| InChI | InChI=1S/C24H30N4O4/c1-3-32-22-6-4-5-19(15-22)16-28(17-23(30)27-13-11-25-12-14-27)24(31)20-7-9-21(10-8-20)26-18(2)29/h4-10,15,25H,3,11-14,16-17H2,1-2H3,(H,26,29) |
| InChIKey | ONKVRAXAHNAOIR-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |