About 3-methylbenzamide;2-methylpropane
3-methylbenzamide;2-methylpropane (PubChem CID 160767336) has the molecular formula C12H19NO
and a molecular weight of 193.29 g/mol. Its IUPAC name is 3-methylbenzamide;2-methylpropane.
Molecular Properties
| Compound Name | 3-methylbenzamide;2-methylpropane |
| PubChem CID | 160767336 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | 3-methylbenzamide;2-methylpropane |
| SMILES | CC(C)C.Cc1cccc(C(N)=O)c1 |
| InChI | InChI=1S/C8H9NO.C4H10/c1-6-3-2-4-7(5-6)8(9)10;1-4(2)3/h2-5H,1H3,(H2,9,10);4H,1-3H3 |
| InChIKey | RYVRUBNNZUSWIA-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-methylbenzamide;2-methylpropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylbenzamide;2-methylpropane?
The IUPAC name of 3-methylbenzamide;2-methylpropane (CID 160767336) is 3-methylbenzamide;2-methylpropane.
What is the SMILES notation for 3-methylbenzamide;2-methylpropane?
The canonical SMILES for 3-methylbenzamide;2-methylpropane is CC(C)C.Cc1cccc(C(N)=O)c1.
What is the InChIKey of 3-methylbenzamide;2-methylpropane?
The InChIKey is RYVRUBNNZUSWIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO.C4H10/c1-6-3-2-4-7(5-6)8(9)10;1-4(2)3/h2-5H,1H3,(H2,9,10);4H,1-3H3.
What are the key properties of 3-methylbenzamide;2-methylpropane?
3-methylbenzamide;2-methylpropane has a molecular weight of 193.29 g/mol, XLogP of 2.76, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylbenzamide;2-methylpropane is sourced from PubChem (CID 160767336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).