About 2-chloro-5-methylpyridine;ethane;3-methylbenzamide
2-chloro-5-methylpyridine;ethane;3-methylbenzamide (PubChem CID 142196503) has the molecular formula C16H21ClN2O
and a molecular weight of 292.81 g/mol. Its IUPAC name is 2-chloro-5-methylpyridine;ethane;3-methylbenzamide.
Molecular Properties
| Compound Name | 2-chloro-5-methylpyridine;ethane;3-methylbenzamide |
| PubChem CID | 142196503 |
| Molecular Formula | C16H21ClN2O |
| Molecular Weight | 292.81 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | 2-chloro-5-methylpyridine;ethane;3-methylbenzamide |
| SMILES | CC.Cc1ccc(Cl)nc1.Cc1cccc(C(N)=O)c1 |
| InChI | InChI=1S/C8H9NO.C6H6ClN.C2H6/c1-6-3-2-4-7(5-6)8(9)10;1-5-2-3-6(7)8-4-5;1-2/h2-5H,1H3,(H2,9,10);2-4H,1H3;1-2H3 |
| InChIKey | WMVFZUXAXQLVFE-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.81 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-5-methylpyridine;ethane;3-methylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-5-methylpyridine;ethane;3-methylbenzamide?
The IUPAC name of 2-chloro-5-methylpyridine;ethane;3-methylbenzamide (CID 142196503) is 2-chloro-5-methylpyridine;ethane;3-methylbenzamide.
What is the SMILES notation for 2-chloro-5-methylpyridine;ethane;3-methylbenzamide?
The canonical SMILES for 2-chloro-5-methylpyridine;ethane;3-methylbenzamide is CC.Cc1ccc(Cl)nc1.Cc1cccc(C(N)=O)c1.
What is the InChIKey of 2-chloro-5-methylpyridine;ethane;3-methylbenzamide?
The InChIKey is WMVFZUXAXQLVFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO.C6H6ClN.C2H6/c1-6-3-2-4-7(5-6)8(9)10;1-5-2-3-6(7)8-4-5;1-2/h2-5H,1H3,(H2,9,10);2-4H,1H3;1-2H3.
What are the key properties of 2-chloro-5-methylpyridine;ethane;3-methylbenzamide?
2-chloro-5-methylpyridine;ethane;3-methylbenzamide has a molecular weight of 292.81 g/mol, XLogP of 4.16, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-5-methylpyridine;ethane;3-methylbenzamide is sourced from PubChem (CID 142196503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).