About 2-chloro-5-methylpyridine;3-methylpyridine
2-chloro-5-methylpyridine;3-methylpyridine (PubChem CID 143093216) has the molecular formula C12H13ClN2
and a molecular weight of 220.70 g/mol. Its IUPAC name is 2-chloro-5-methylpyridine;3-methylpyridine.
Molecular Properties
| Compound Name | 2-chloro-5-methylpyridine;3-methylpyridine |
| PubChem CID | 143093216 |
| Molecular Formula | C12H13ClN2 |
| Molecular Weight | 220.70 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | 2-chloro-5-methylpyridine;3-methylpyridine |
| SMILES | Cc1ccc(Cl)nc1.Cc1cccnc1 |
| InChI | InChI=1S/C6H6ClN.C6H7N/c1-5-2-3-6(7)8-4-5;1-6-3-2-4-7-5-6/h2-4H,1H3;2-5H,1H3 |
| InChIKey | HSHAUVQKXFFMFV-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.70 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-5-methylpyridine;3-methylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-5-methylpyridine;3-methylpyridine?
The IUPAC name of 2-chloro-5-methylpyridine;3-methylpyridine (CID 143093216) is 2-chloro-5-methylpyridine;3-methylpyridine.
What is the SMILES notation for 2-chloro-5-methylpyridine;3-methylpyridine?
The canonical SMILES for 2-chloro-5-methylpyridine;3-methylpyridine is Cc1ccc(Cl)nc1.Cc1cccnc1.
What is the InChIKey of 2-chloro-5-methylpyridine;3-methylpyridine?
The InChIKey is HSHAUVQKXFFMFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6ClN.C6H7N/c1-5-2-3-6(7)8-4-5;1-6-3-2-4-7-5-6/h2-4H,1H3;2-5H,1H3.
What are the key properties of 2-chloro-5-methylpyridine;3-methylpyridine?
2-chloro-5-methylpyridine;3-methylpyridine has a molecular weight of 220.70 g/mol, XLogP of 3.43, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-5-methylpyridine;3-methylpyridine is sourced from PubChem (CID 143093216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).