About bis(3-methylpyridine);tetrachloroplatinum
bis(3-methylpyridine);tetrachloroplatinum (PubChem CID 3415062) has the molecular formula C12H14Cl4N2Pt
and a molecular weight of 523.15 g/mol. Its IUPAC name is bis(3-methylpyridine);tetrachloroplatinum.
Molecular Properties
| Compound Name | bis(3-methylpyridine);tetrachloroplatinum |
| PubChem CID | 3415062 |
| Molecular Formula | C12H14Cl4N2Pt |
| Molecular Weight | 523.15 g/mol |
| Exact Mass | 520.96 |
| IUPAC Name | bis(3-methylpyridine);tetrachloroplatinum |
| SMILES | Cc1cccnc1.Cc1cccnc1.Cl[Pt](Cl)(Cl)Cl |
| InChI | InChI=1S/2C6H7N.4ClH.Pt/c2*1-6-3-2-4-7-5-6;;;;;/h2*2-5H,1H3;4*1H;/q;;;;;;+4/p-4 |
| InChIKey | AZACYAHTKNTPNQ-UHFFFAOYSA-J |
| XLogP | 5.54 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 523.15 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze bis(3-methylpyridine);tetrachloroplatinum with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(3-methylpyridine);tetrachloroplatinum?
The IUPAC name of bis(3-methylpyridine);tetrachloroplatinum (CID 3415062) is bis(3-methylpyridine);tetrachloroplatinum.
What is the SMILES notation for bis(3-methylpyridine);tetrachloroplatinum?
The canonical SMILES for bis(3-methylpyridine);tetrachloroplatinum is Cc1cccnc1.Cc1cccnc1.Cl[Pt](Cl)(Cl)Cl.
What is the InChIKey of bis(3-methylpyridine);tetrachloroplatinum?
The InChIKey is AZACYAHTKNTPNQ-UHFFFAOYSA-J. The full InChI is InChI=1S/2C6H7N.4ClH.Pt/c2*1-6-3-2-4-7-5-6;;;;;/h2*2-5H,1H3;4*1H;/q;;;;;;+4/p-4.
What are the key properties of bis(3-methylpyridine);tetrachloroplatinum?
bis(3-methylpyridine);tetrachloroplatinum has a molecular weight of 523.15 g/mol, XLogP of 5.54, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bis(3-methylpyridine);tetrachloroplatinum is sourced from PubChem (CID 3415062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).