C8H10Cl3N — CID 163849047
2-chloro-5-methylpyridine;1,1-dichloroethane (PubChem CID 163849047) has the molecular formula C8H10Cl3N and a molecular weight of 226.53 g/mol. Its IUPAC name is 2-chloro-5-methylpyridine;1,1-dichloroethane.
| Compound Name | 2-chloro-5-methylpyridine;1,1-dichloroethane |
|---|---|
| PubChem CID | 163849047 |
| Molecular Formula | C8H10Cl3N |
| Molecular Weight | 226.53 g/mol |
| Exact Mass | 224.99 |
| IUPAC Name | 2-chloro-5-methylpyridine;1,1-dichloroethane |
| SMILES | CC(Cl)Cl.Cc1ccc(Cl)nc1 |
| InChI | InChI=1S/C6H6ClN.C2H4Cl2/c1-5-2-3-6(7)8-4-5;1-2(3)4/h2-4H,1H3;2H,1H3 |
| InChIKey | OSSVUXBOTDGDMD-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.53 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|