C14H14N2O — CID 90320998
3-(2,5-dimethyl-3-pyridinyl)benzamide (PubChem CID 90320998) has the molecular formula C14H14N2O and a molecular weight of 226.28 g/mol. Its IUPAC name is 3-(2,5-dimethyl-3-pyridinyl)benzamide.
| Compound Name | 3-(2,5-dimethyl-3-pyridinyl)benzamide |
|---|---|
| PubChem CID | 90320998 |
| Molecular Formula | C14H14N2O |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | 3-(2,5-dimethyl-3-pyridinyl)benzamide |
| SMILES | Cc1cnc(C)c(-c2cccc(C(N)=O)c2)c1 |
| InChI | InChI=1S/C14H14N2O/c1-9-6-13(10(2)16-8-9)11-4-3-5-12(7-11)14(15)17/h3-8H,1-2H3,(H2,15,17) |
| InChIKey | SZNFQJFRBSZJSK-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |