C17H17O5P — CID 66796244
[1,3-bis(3-methylphenyl)-1,3-dioxopropan-2-yl]phosphonic acid (PubChem CID 66796244) has the molecular formula C17H17O5P and a molecular weight of 332.29 g/mol. Its IUPAC name is [1,3-bis(3-methylphenyl)-1,3-dioxopropan-2-yl]phosphonic acid.
| Compound Name | [1,3-bis(3-methylphenyl)-1,3-dioxopropan-2-yl]phosphonic acid |
|---|---|
| PubChem CID | 66796244 |
| Molecular Formula | C17H17O5P |
| Molecular Weight | 332.29 g/mol |
| Exact Mass | 332.08 |
| IUPAC Name | [1,3-bis(3-methylphenyl)-1,3-dioxopropan-2-yl]phosphonic acid |
| SMILES | Cc1cccc(C(=O)C(C(=O)c2cccc(C)c2)P(=O)(O)O)c1 |
| InChI | InChI=1S/C17H17O5P/c1-11-5-3-7-13(9-11)15(18)17(23(20,21)22)16(19)14-8-4-6-12(2)10-14/h3-10,17H,1-2H3,(H2,20,21,22) |
| InChIKey | NKMUYMSXDQWIKT-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.29 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|