About ethane;methanol;1,3-xylene
ethane;methanol;1,3-xylene (PubChem CID 156743127) has the molecular formula C11H20O
and a molecular weight of 168.28 g/mol. Its IUPAC name is ethane;methanol;1,3-xylene.
Molecular Properties
| Compound Name | ethane;methanol;1,3-xylene |
| PubChem CID | 156743127 |
| Molecular Formula | C11H20O |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.15 |
| IUPAC Name | ethane;methanol;1,3-xylene |
| SMILES | CC.CO.Cc1cccc(C)c1 |
| InChI | InChI=1S/C8H10.C2H6.CH4O/c1-7-4-3-5-8(2)6-7;2*1-2/h3-6H,1-2H3;1-2H3;2H,1H3 |
| InChIKey | OZHHMEHLMFLVED-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;methanol;1,3-xylene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methanol;1,3-xylene?
The IUPAC name of ethane;methanol;1,3-xylene (CID 156743127) is ethane;methanol;1,3-xylene.
What is the SMILES notation for ethane;methanol;1,3-xylene?
The canonical SMILES for ethane;methanol;1,3-xylene is CC.CO.Cc1cccc(C)c1.
What is the InChIKey of ethane;methanol;1,3-xylene?
The InChIKey is OZHHMEHLMFLVED-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10.C2H6.CH4O/c1-7-4-3-5-8(2)6-7;2*1-2/h3-6H,1-2H3;1-2H3;2H,1H3.
What are the key properties of ethane;methanol;1,3-xylene?
ethane;methanol;1,3-xylene has a molecular weight of 168.28 g/mol, XLogP of 2.94, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methanol;1,3-xylene is sourced from PubChem (CID 156743127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).