C8H12O4S — CID 70361760
sulfuric acid;1,3-xylene (PubChem CID 70361760) has the molecular formula C8H12O4S and a molecular weight of 204.25 g/mol. Its IUPAC name is sulfuric acid;1,3-xylene.
| Compound Name | sulfuric acid;1,3-xylene |
|---|---|
| PubChem CID | 70361760 |
| Molecular Formula | C8H12O4S |
| Molecular Weight | 204.25 g/mol |
| Exact Mass | 204.05 |
| IUPAC Name | sulfuric acid;1,3-xylene |
| SMILES | Cc1cccc(C)c1.O=S(=O)(O)O |
| InChI | InChI=1S/C8H10.H2O4S/c1-7-4-3-5-8(2)6-7;1-5(2,3)4/h3-6H,1-2H3;(H2,1,2,3,4) |
| InChIKey | JOQLQKGHWQXYFR-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.25 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|