About 3-methylphenol;sulfuric acid
3-methylphenol;sulfuric acid (PubChem CID 70180616) has the molecular formula C7H10O5S
and a molecular weight of 206.22 g/mol. Its IUPAC name is 3-methylphenol;sulfuric acid.
Molecular Properties
| Compound Name | 3-methylphenol;sulfuric acid |
| PubChem CID | 70180616 |
| Molecular Formula | C7H10O5S |
| Molecular Weight | 206.22 g/mol |
| Exact Mass | 206.02 |
| IUPAC Name | 3-methylphenol;sulfuric acid |
| SMILES | Cc1cccc(O)c1.O=S(=O)(O)O |
| InChI | InChI=1S/C7H8O.H2O4S/c1-6-3-2-4-7(8)5-6;1-5(2,3)4/h2-5,8H,1H3;(H2,1,2,3,4) |
| InChIKey | BSYOWWQUEHGEEB-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.22 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 3-methylphenol;sulfuric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylphenol;sulfuric acid?
The IUPAC name of 3-methylphenol;sulfuric acid (CID 70180616) is 3-methylphenol;sulfuric acid.
What is the SMILES notation for 3-methylphenol;sulfuric acid?
The canonical SMILES for 3-methylphenol;sulfuric acid is Cc1cccc(O)c1.O=S(=O)(O)O.
What is the InChIKey of 3-methylphenol;sulfuric acid?
The InChIKey is BSYOWWQUEHGEEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O.H2O4S/c1-6-3-2-4-7(8)5-6;1-5(2,3)4/h2-5,8H,1H3;(H2,1,2,3,4).
What are the key properties of 3-methylphenol;sulfuric acid?
3-methylphenol;sulfuric acid has a molecular weight of 206.22 g/mol, XLogP of 1.05, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylphenol;sulfuric acid is sourced from PubChem (CID 70180616), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).