C17H20O — CID 67864963
bis(cyclopenta-1,3-diene);3-methylphenol (PubChem CID 67864963) has the molecular formula C17H20O and a molecular weight of 240.35 g/mol. Its IUPAC name is bis(cyclopenta-1,3-diene);3-methylphenol.
| Compound Name | bis(cyclopenta-1,3-diene);3-methylphenol |
|---|---|
| PubChem CID | 67864963 |
| Molecular Formula | C17H20O |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | bis(cyclopenta-1,3-diene);3-methylphenol |
| SMILES | C1=CCC=C1.C1=CCC=C1.Cc1cccc(O)c1 |
| InChI | InChI=1S/C7H8O.2C5H6/c1-6-3-2-4-7(8)5-6;2*1-2-4-5-3-1/h2-5,8H,1H3;2*1-4H,5H2 |
| InChIKey | NMHBBRYEBZUWNW-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |