C13H16O — CID 170171549
cyclopenta-1,3-diene;2,3-dimethylphenol (PubChem CID 170171549) has the molecular formula C13H16O and a molecular weight of 188.27 g/mol. Its IUPAC name is cyclopenta-1,3-diene;2,3-dimethylphenol.
| Compound Name | cyclopenta-1,3-diene;2,3-dimethylphenol |
|---|---|
| PubChem CID | 170171549 |
| Molecular Formula | C13H16O |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.12 |
| IUPAC Name | cyclopenta-1,3-diene;2,3-dimethylphenol |
| SMILES | C1=CCC=C1.Cc1cccc(O)c1C |
| InChI | InChI=1S/C8H10O.C5H6/c1-6-4-3-5-8(9)7(6)2;1-2-4-5-3-1/h3-5,9H,1-2H3;1-4H,5H2 |
| InChIKey | HCQLXCVVRYTQBS-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |