About 3-methylphenol;pentan-3-one
3-methylphenol;pentan-3-one (PubChem CID 174814011) has the molecular formula C12H18O2
and a molecular weight of 194.27 g/mol. Its IUPAC name is 3-methylphenol;pentan-3-one.
Molecular Properties
| Compound Name | 3-methylphenol;pentan-3-one |
| PubChem CID | 174814011 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | 3-methylphenol;pentan-3-one |
| SMILES | CCC(=O)CC.Cc1cccc(O)c1 |
| InChI | InChI=1S/C7H8O.C5H10O/c1-6-3-2-4-7(8)5-6;1-3-5(6)4-2/h2-5,8H,1H3;3-4H2,1-2H3 |
| InChIKey | UHAIYWXNGHJAQN-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-methylphenol;pentan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylphenol;pentan-3-one?
The IUPAC name of 3-methylphenol;pentan-3-one (CID 174814011) is 3-methylphenol;pentan-3-one.
What is the SMILES notation for 3-methylphenol;pentan-3-one?
The canonical SMILES for 3-methylphenol;pentan-3-one is CCC(=O)CC.Cc1cccc(O)c1.
What is the InChIKey of 3-methylphenol;pentan-3-one?
The InChIKey is UHAIYWXNGHJAQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O.C5H10O/c1-6-3-2-4-7(8)5-6;1-3-5(6)4-2/h2-5,8H,1H3;3-4H2,1-2H3.
What are the key properties of 3-methylphenol;pentan-3-one?
3-methylphenol;pentan-3-one has a molecular weight of 194.27 g/mol, XLogP of 3.08, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylphenol;pentan-3-one is sourced from PubChem (CID 174814011), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).