About ethyl cyclopropanecarboxylate;3-methylphenol
ethyl cyclopropanecarboxylate;3-methylphenol (PubChem CID 144863890) has the molecular formula C13H18O3
and a molecular weight of 222.28 g/mol. Its IUPAC name is ethyl cyclopropanecarboxylate;3-methylphenol.
Molecular Properties
| Compound Name | ethyl cyclopropanecarboxylate;3-methylphenol |
| PubChem CID | 144863890 |
| Molecular Formula | C13H18O3 |
| Molecular Weight | 222.28 g/mol |
| Exact Mass | 222.13 |
| IUPAC Name | ethyl cyclopropanecarboxylate;3-methylphenol |
| SMILES | CCOC(=O)C1CC1.Cc1cccc(O)c1 |
| InChI | InChI=1S/C7H8O.C6H10O2/c1-6-3-2-4-7(8)5-6;1-2-8-6(7)5-3-4-5/h2-5,8H,1H3;5H,2-4H2,1H3 |
| InChIKey | HXCPWRLFGOBCLX-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.28 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl cyclopropanecarboxylate;3-methylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl cyclopropanecarboxylate;3-methylphenol?
The IUPAC name of ethyl cyclopropanecarboxylate;3-methylphenol (CID 144863890) is ethyl cyclopropanecarboxylate;3-methylphenol.
What is the SMILES notation for ethyl cyclopropanecarboxylate;3-methylphenol?
The canonical SMILES for ethyl cyclopropanecarboxylate;3-methylphenol is CCOC(=O)C1CC1.Cc1cccc(O)c1.
What is the InChIKey of ethyl cyclopropanecarboxylate;3-methylphenol?
The InChIKey is HXCPWRLFGOBCLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O.C6H10O2/c1-6-3-2-4-7(8)5-6;1-2-8-6(7)5-3-4-5/h2-5,8H,1H3;5H,2-4H2,1H3.
What are the key properties of ethyl cyclopropanecarboxylate;3-methylphenol?
ethyl cyclopropanecarboxylate;3-methylphenol has a molecular weight of 222.28 g/mol, XLogP of 2.66, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl cyclopropanecarboxylate;3-methylphenol is sourced from PubChem (CID 144863890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).