About 1,2-difluorobenzene;ethyl cyclopropanecarboxylate
1,2-difluorobenzene;ethyl cyclopropanecarboxylate (PubChem CID 145194547) has the molecular formula C12H14F2O2
and a molecular weight of 228.24 g/mol. Its IUPAC name is 1,2-difluorobenzene;ethyl cyclopropanecarboxylate.
Molecular Properties
| Compound Name | 1,2-difluorobenzene;ethyl cyclopropanecarboxylate |
| PubChem CID | 145194547 |
| Molecular Formula | C12H14F2O2 |
| Molecular Weight | 228.24 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | 1,2-difluorobenzene;ethyl cyclopropanecarboxylate |
| SMILES | CCOC(=O)C1CC1.Fc1ccccc1F |
| InChI | InChI=1S/C6H4F2.C6H10O2/c7-5-3-1-2-4-6(5)8;1-2-8-6(7)5-3-4-5/h1-4H;5H,2-4H2,1H3 |
| InChIKey | JAZJOHOYQNLPGS-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.24 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,2-difluorobenzene;ethyl cyclopropanecarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-difluorobenzene;ethyl cyclopropanecarboxylate?
The IUPAC name of 1,2-difluorobenzene;ethyl cyclopropanecarboxylate (CID 145194547) is 1,2-difluorobenzene;ethyl cyclopropanecarboxylate.
What is the SMILES notation for 1,2-difluorobenzene;ethyl cyclopropanecarboxylate?
The canonical SMILES for 1,2-difluorobenzene;ethyl cyclopropanecarboxylate is CCOC(=O)C1CC1.Fc1ccccc1F.
What is the InChIKey of 1,2-difluorobenzene;ethyl cyclopropanecarboxylate?
The InChIKey is JAZJOHOYQNLPGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4F2.C6H10O2/c7-5-3-1-2-4-6(5)8;1-2-8-6(7)5-3-4-5/h1-4H;5H,2-4H2,1H3.
What are the key properties of 1,2-difluorobenzene;ethyl cyclopropanecarboxylate?
1,2-difluorobenzene;ethyl cyclopropanecarboxylate has a molecular weight of 228.24 g/mol, XLogP of 2.92, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-difluorobenzene;ethyl cyclopropanecarboxylate is sourced from PubChem (CID 145194547), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).