C15H21FNO2+ — CID 6939614
ethyl (3R)-1-[(2-fluorophenyl)methyl]piperidin-1-ium-3-carboxylate (PubChem CID 6939614) has the molecular formula C15H21FNO2+ and a molecular weight of 266.34 g/mol. Its IUPAC name is ethyl (3R)-1-[(2-fluorophenyl)methyl]piperidin-1-ium-3-carboxylate.
| Compound Name | ethyl (3R)-1-[(2-fluorophenyl)methyl]piperidin-1-ium-3-carboxylate |
|---|---|
| PubChem CID | 6939614 |
| Molecular Formula | C15H21FNO2+ |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | ethyl (3R)-1-[(2-fluorophenyl)methyl]piperidin-1-ium-3-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CCC[NH+](Cc2ccccc2F)C1 |
| InChI | InChI=1S/C15H20FNO2/c1-2-19-15(18)13-7-5-9-17(11-13)10-12-6-3-4-8-14(12)16/h3-4,6,8,13H,2,5,7,9-11H2,1H3/p+1/t13-/m1/s1 |
| InChIKey | AMKUTZRLOAXXMQ-CYBMUJFWSA-O |
| XLogP | 1.18 |
| TPSA | 30.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |