C15H21ClNO2+ — CID 6939655
ethyl (3S)-1-[(2-chlorophenyl)methyl]piperidin-1-ium-3-carboxylate (PubChem CID 6939655) has the molecular formula C15H21ClNO2+ and a molecular weight of 282.79 g/mol. Its IUPAC name is ethyl (3S)-1-[(2-chlorophenyl)methyl]piperidin-1-ium-3-carboxylate.
| Compound Name | ethyl (3S)-1-[(2-chlorophenyl)methyl]piperidin-1-ium-3-carboxylate |
|---|---|
| PubChem CID | 6939655 |
| Molecular Formula | C15H21ClNO2+ |
| Molecular Weight | 282.79 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | ethyl (3S)-1-[(2-chlorophenyl)methyl]piperidin-1-ium-3-carboxylate |
| SMILES | CCOC(=O)[C@H]1CCC[NH+](Cc2ccccc2Cl)C1 |
| InChI | InChI=1S/C15H20ClNO2/c1-2-19-15(18)13-7-5-9-17(11-13)10-12-6-3-4-8-14(12)16/h3-4,6,8,13H,2,5,7,9-11H2,1H3/p+1/t13-/m0/s1 |
| InChIKey | ANHCYNHTKSMBLG-ZDUSSCGKSA-O |
| XLogP | 1.70 |
| TPSA | 30.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.79 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |