C21H25ClNO3+ — CID 7446373
ethyl (3S)-1-[[3-(4-chlorophenoxy)phenyl]methyl]piperidin-1-ium-3-carboxylate (PubChem CID 7446373) has the molecular formula C21H25ClNO3+ and a molecular weight of 374.89 g/mol. Its IUPAC name is ethyl (3S)-1-[[3-(4-chlorophenoxy)phenyl]methyl]piperidin-1-ium-3-carboxylate.
| Compound Name | ethyl (3S)-1-[[3-(4-chlorophenoxy)phenyl]methyl]piperidin-1-ium-3-carboxylate |
|---|---|
| PubChem CID | 7446373 |
| Molecular Formula | C21H25ClNO3+ |
| Molecular Weight | 374.89 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | ethyl (3S)-1-[[3-(4-chlorophenoxy)phenyl]methyl]piperidin-1-ium-3-carboxylate |
| SMILES | CCOC(=O)[C@H]1CCC[NH+](Cc2cccc(Oc3ccc(Cl)cc3)c2)C1 |
| InChI | InChI=1S/C21H24ClNO3/c1-2-25-21(24)17-6-4-12-23(15-17)14-16-5-3-7-20(13-16)26-19-10-8-18(22)9-11-19/h3,5,7-11,13,17H,2,4,6,12,14-15H2,1H3/p+1/t17-/m0/s1 |
| InChIKey | JPSXRMCIHYDRCI-KRWDZBQOSA-O |
| XLogP | 3.49 |
| TPSA | 39.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.89 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |