C19H24NO+ — CID 7445628
(3R)-3-methyl-1-[(3-phenoxyphenyl)methyl]piperidin-1-ium (PubChem CID 7445628) has the molecular formula C19H24NO+ and a molecular weight of 282.41 g/mol. Its IUPAC name is (3R)-3-methyl-1-[(3-phenoxyphenyl)methyl]piperidin-1-ium.
| Compound Name | (3R)-3-methyl-1-[(3-phenoxyphenyl)methyl]piperidin-1-ium |
|---|---|
| PubChem CID | 7445628 |
| Molecular Formula | C19H24NO+ |
| Molecular Weight | 282.41 g/mol |
| Exact Mass | 282.19 |
| IUPAC Name | (3R)-3-methyl-1-[(3-phenoxyphenyl)methyl]piperidin-1-ium |
| SMILES | C[C@@H]1CCC[NH+](Cc2cccc(Oc3ccccc3)c2)C1 |
| InChI | InChI=1S/C19H23NO/c1-16-7-6-12-20(14-16)15-17-8-5-11-19(13-17)21-18-9-3-2-4-10-18/h2-5,8-11,13,16H,6-7,12,14-15H2,1H3/p+1/t16-/m1/s1 |
| InChIKey | VAWKTHGPQLDLLH-MRXNPFEDSA-O |
| XLogP | 3.29 |
| TPSA | 13.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.41 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |