C28H33N2O2+ — CID 7324338
N-benzyl-N-ethyl-1-[(3-phenoxyphenyl)methyl]piperidin-1-ium-4-carboxamide (PubChem CID 7324338) has the molecular formula C28H33N2O2+ and a molecular weight of 429.58 g/mol. Its IUPAC name is N-benzyl-N-ethyl-1-[(3-phenoxyphenyl)methyl]piperidin-1-ium-4-carboxamide.
| Compound Name | N-benzyl-N-ethyl-1-[(3-phenoxyphenyl)methyl]piperidin-1-ium-4-carboxamide |
|---|---|
| PubChem CID | 7324338 |
| Molecular Formula | C28H33N2O2+ |
| Molecular Weight | 429.58 g/mol |
| Exact Mass | 429.25 |
| IUPAC Name | N-benzyl-N-ethyl-1-[(3-phenoxyphenyl)methyl]piperidin-1-ium-4-carboxamide |
| SMILES | CCN(Cc1ccccc1)C(=O)C1CC[NH+](Cc2cccc(Oc3ccccc3)c2)CC1 |
| InChI | InChI=1S/C28H32N2O2/c1-2-30(22-23-10-5-3-6-11-23)28(31)25-16-18-29(19-17-25)21-24-12-9-15-27(20-24)32-26-13-7-4-8-14-26/h3-15,20,25H,2,16-19,21-22H2,1H3/p+1 |
| InChIKey | IZEBWUONDPBWSO-UHFFFAOYSA-O |
| XLogP | 4.32 |
| TPSA | 33.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.58 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |