C19H26N2O+2 — CID 7439200
1-ethyl-4-[(3-phenoxyphenyl)methyl]piperazine-1,4-diium (PubChem CID 7439200) has the molecular formula C19H26N2O+2 and a molecular weight of 298.43 g/mol. Its IUPAC name is 1-ethyl-4-[(3-phenoxyphenyl)methyl]piperazine-1,4-diium.
| Compound Name | 1-ethyl-4-[(3-phenoxyphenyl)methyl]piperazine-1,4-diium |
|---|---|
| PubChem CID | 7439200 |
| Molecular Formula | C19H26N2O+2 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.20 |
| IUPAC Name | 1-ethyl-4-[(3-phenoxyphenyl)methyl]piperazine-1,4-diium |
| SMILES | CC[NH+]1CC[NH+](Cc2cccc(Oc3ccccc3)c2)CC1 |
| InChI | InChI=1S/C19H24N2O/c1-2-20-11-13-21(14-12-20)16-17-7-6-10-19(15-17)22-18-8-4-3-5-9-18/h3-10,15H,2,11-14,16H2,1H3/p+2 |
| InChIKey | XPEAQMFGWXPDJU-UHFFFAOYSA-P |
| XLogP | 0.78 |
| TPSA | 18.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |