C20H28N2O2+2 — CID 7484402
1-ethyl-4-[2-(3-phenoxyphenoxy)ethyl]piperazine-1,4-diium (PubChem CID 7484402) has the molecular formula C20H28N2O2+2 and a molecular weight of 328.46 g/mol. Its IUPAC name is 1-ethyl-4-[2-(3-phenoxyphenoxy)ethyl]piperazine-1,4-diium.
| Compound Name | 1-ethyl-4-[2-(3-phenoxyphenoxy)ethyl]piperazine-1,4-diium |
|---|---|
| PubChem CID | 7484402 |
| Molecular Formula | C20H28N2O2+2 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.21 |
| IUPAC Name | 1-ethyl-4-[2-(3-phenoxyphenoxy)ethyl]piperazine-1,4-diium |
| SMILES | CC[NH+]1CC[NH+](CCOc2cccc(Oc3ccccc3)c2)CC1 |
| InChI | InChI=1S/C20H26N2O2/c1-2-21-11-13-22(14-12-21)15-16-23-19-9-6-10-20(17-19)24-18-7-4-3-5-8-18/h3-10,17H,2,11-16H2,1H3/p+2 |
| InChIKey | ZMWKFSKLWQPAOQ-UHFFFAOYSA-P |
| XLogP | 0.66 |
| TPSA | 27.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |