C13H22N2O2+2 — CID 6939219
1-[2-(3-methoxyphenoxy)ethyl]piperazine-1,4-diium (PubChem CID 6939219) has the molecular formula C13H22N2O2+2 and a molecular weight of 238.33 g/mol. Its IUPAC name is 1-[2-(3-methoxyphenoxy)ethyl]piperazine-1,4-diium.
| Compound Name | 1-[2-(3-methoxyphenoxy)ethyl]piperazine-1,4-diium |
|---|---|
| PubChem CID | 6939219 |
| Molecular Formula | C13H22N2O2+2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.17 |
| IUPAC Name | 1-[2-(3-methoxyphenoxy)ethyl]piperazine-1,4-diium |
| SMILES | COc1cccc(OCC[NH+]2CC[NH2+]CC2)c1 |
| InChI | InChI=1S/C13H20N2O2/c1-16-12-3-2-4-13(11-12)17-10-9-15-7-5-14-6-8-15/h2-4,11,14H,5-10H2,1H3/p+2 |
| InChIKey | RKKDHOAVZQZXCE-UHFFFAOYSA-P |
| XLogP | -1.46 |
| TPSA | 39.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | -1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |