C17H30N2O+2 — CID 7443365
1-[2-[4-(2-methylbutan-2-yl)phenoxy]ethyl]piperazine-1,4-diium (PubChem CID 7443365) has the molecular formula C17H30N2O+2 and a molecular weight of 278.44 g/mol. Its IUPAC name is 1-[2-[4-(2-methylbutan-2-yl)phenoxy]ethyl]piperazine-1,4-diium.
| Compound Name | 1-[2-[4-(2-methylbutan-2-yl)phenoxy]ethyl]piperazine-1,4-diium |
|---|---|
| PubChem CID | 7443365 |
| Molecular Formula | C17H30N2O+2 |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.23 |
| IUPAC Name | 1-[2-[4-(2-methylbutan-2-yl)phenoxy]ethyl]piperazine-1,4-diium |
| SMILES | CCC(C)(C)c1ccc(OCC[NH+]2CC[NH2+]CC2)cc1 |
| InChI | InChI=1S/C17H28N2O/c1-4-17(2,3)15-5-7-16(8-6-15)20-14-13-19-11-9-18-10-12-19/h5-8,18H,4,9-14H2,1-3H3/p+2 |
| InChIKey | ZBIJRRQSIPYPQJ-UHFFFAOYSA-P |
| XLogP | 0.21 |
| TPSA | 30.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |