C12H19IN2O+2 — CID 7244694
1-[2-(4-iodophenoxy)ethyl]piperazine-1,4-diium (PubChem CID 7244694) has the molecular formula C12H19IN2O+2 and a molecular weight of 334.20 g/mol. Its IUPAC name is 1-[2-(4-iodophenoxy)ethyl]piperazine-1,4-diium.
| Compound Name | 1-[2-(4-iodophenoxy)ethyl]piperazine-1,4-diium |
|---|---|
| PubChem CID | 7244694 |
| Molecular Formula | C12H19IN2O+2 |
| Molecular Weight | 334.20 g/mol |
| Exact Mass | 334.05 |
| IUPAC Name | 1-[2-(4-iodophenoxy)ethyl]piperazine-1,4-diium |
| SMILES | Ic1ccc(OCC[NH+]2CC[NH2+]CC2)cc1 |
| InChI | InChI=1S/C12H17IN2O/c13-11-1-3-12(4-2-11)16-10-9-15-7-5-14-6-8-15/h1-4,14H,5-10H2/p+2 |
| InChIKey | WJJQCUSDKDWEAM-UHFFFAOYSA-P |
| XLogP | -0.87 |
| TPSA | 30.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.20 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|