C14H23ClN2O+2 — CID 2194944
1-[4-(4-chlorophenoxy)butyl]piperazine-1,4-diium (PubChem CID 2194944) has the molecular formula C14H23ClN2O+2 and a molecular weight of 270.80 g/mol. Its IUPAC name is 1-[4-(4-chlorophenoxy)butyl]piperazine-1,4-diium.
| Compound Name | 1-[4-(4-chlorophenoxy)butyl]piperazine-1,4-diium |
|---|---|
| PubChem CID | 2194944 |
| Molecular Formula | C14H23ClN2O+2 |
| Molecular Weight | 270.80 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | 1-[4-(4-chlorophenoxy)butyl]piperazine-1,4-diium |
| SMILES | Clc1ccc(OCCCC[NH+]2CC[NH2+]CC2)cc1 |
| InChI | InChI=1S/C14H21ClN2O/c15-13-3-5-14(6-4-13)18-12-2-1-9-17-10-7-16-8-11-17/h3-6,16H,1-2,7-12H2/p+2 |
| InChIKey | VAZDBXNKKIWEKP-UHFFFAOYSA-P |
| XLogP | -0.04 |
| TPSA | 30.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.80 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|