C19H23ClNO+ — CID 2195313
2-[4-(4-chlorophenoxy)butyl]-1,2,3,4-tetrahydroisoquinolin-2-ium (PubChem CID 2195313) has the molecular formula C19H23ClNO+ and a molecular weight of 316.85 g/mol. Its IUPAC name is 2-[4-(4-chlorophenoxy)butyl]-1,2,3,4-tetrahydroisoquinolin-2-ium.
| Compound Name | 2-[4-(4-chlorophenoxy)butyl]-1,2,3,4-tetrahydroisoquinolin-2-ium |
|---|---|
| PubChem CID | 2195313 |
| Molecular Formula | C19H23ClNO+ |
| Molecular Weight | 316.85 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | 2-[4-(4-chlorophenoxy)butyl]-1,2,3,4-tetrahydroisoquinolin-2-ium |
| SMILES | Clc1ccc(OCCCC[NH+]2CCc3ccccc3C2)cc1 |
| InChI | InChI=1S/C19H22ClNO/c20-18-7-9-19(10-8-18)22-14-4-3-12-21-13-11-16-5-1-2-6-17(16)15-21/h1-2,5-10H,3-4,11-15H2/p+1 |
| InChIKey | PIIMDINTTDAQQE-UHFFFAOYSA-O |
| XLogP | 3.14 |
| TPSA | 13.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.85 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|