C17H17ClF2O2S — CID 151713420
1-[5-(benzenesulfinyl)-5,5-difluoropentoxy]-4-chlorobenzene (PubChem CID 151713420) has the molecular formula C17H17ClF2O2S and a molecular weight of 358.84 g/mol. Its IUPAC name is 1-[5-(benzenesulfinyl)-5,5-difluoropentoxy]-4-chlorobenzene.
| Compound Name | 1-[5-(benzenesulfinyl)-5,5-difluoropentoxy]-4-chlorobenzene |
|---|---|
| PubChem CID | 151713420 |
| Molecular Formula | C17H17ClF2O2S |
| Molecular Weight | 358.84 g/mol |
| Exact Mass | 358.06 |
| IUPAC Name | 1-[5-(benzenesulfinyl)-5,5-difluoropentoxy]-4-chlorobenzene |
| SMILES | O=S(c1ccccc1)C(F)(F)CCCCOc1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H17ClF2O2S/c18-14-8-10-15(11-9-14)22-13-5-4-12-17(19,20)23(21)16-6-2-1-3-7-16/h1-3,6-11H,4-5,12-13H2 |
| InChIKey | RHAMACLXBPCMHS-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.84 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|