C18H23ClNO+ — CID 2182151
4-(4-chlorophenoxy)butyl-[(1S)-1-phenylethyl]azanium (PubChem CID 2182151) has the molecular formula C18H23ClNO+ and a molecular weight of 304.84 g/mol. Its IUPAC name is 4-(4-chlorophenoxy)butyl-[(1S)-1-phenylethyl]azanium.
| Compound Name | 4-(4-chlorophenoxy)butyl-[(1S)-1-phenylethyl]azanium |
|---|---|
| PubChem CID | 2182151 |
| Molecular Formula | C18H23ClNO+ |
| Molecular Weight | 304.84 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | 4-(4-chlorophenoxy)butyl-[(1S)-1-phenylethyl]azanium |
| SMILES | C[C@H]([NH2+]CCCCOc1ccc(Cl)cc1)c1ccccc1 |
| InChI | InChI=1S/C18H22ClNO/c1-15(16-7-3-2-4-8-16)20-13-5-6-14-21-18-11-9-17(19)10-12-18/h2-4,7-12,15,20H,5-6,13-14H2,1H3/p+1/t15-/m0/s1 |
| InChIKey | DMVIYWDTKQDJKV-HNNXBMFYSA-O |
| XLogP | 3.82 |
| TPSA | 25.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.84 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|