C14H18Cl2O2 — CID 10039793
6-(4-chlorophenoxy)-2,2-dimethylhexanoyl chloride (PubChem CID 10039793) has the molecular formula C14H18Cl2O2 and a molecular weight of 289.20 g/mol. Its IUPAC name is 6-(4-chlorophenoxy)-2,2-dimethylhexanoyl chloride.
| Compound Name | 6-(4-chlorophenoxy)-2,2-dimethylhexanoyl chloride |
|---|---|
| PubChem CID | 10039793 |
| Molecular Formula | C14H18Cl2O2 |
| Molecular Weight | 289.20 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | 6-(4-chlorophenoxy)-2,2-dimethylhexanoyl chloride |
| SMILES | CC(C)(CCCCOc1ccc(Cl)cc1)C(=O)Cl |
| InChI | InChI=1S/C14H18Cl2O2/c1-14(2,13(16)17)9-3-4-10-18-12-7-5-11(15)6-8-12/h5-8H,3-4,9-10H2,1-2H3 |
| InChIKey | DXXPMFKASGOCJC-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.20 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|