C19H20ClFO3 — CID 13322877
5-(4-chlorophenoxy)-1-(4-fluorophenoxy)-3,3-dimethylpentan-2-one (PubChem CID 13322877) has the molecular formula C19H20ClFO3 and a molecular weight of 350.82 g/mol. Its IUPAC name is 5-(4-chlorophenoxy)-1-(4-fluorophenoxy)-3,3-dimethylpentan-2-one.
| Compound Name | 5-(4-chlorophenoxy)-1-(4-fluorophenoxy)-3,3-dimethylpentan-2-one |
|---|---|
| PubChem CID | 13322877 |
| Molecular Formula | C19H20ClFO3 |
| Molecular Weight | 350.82 g/mol |
| Exact Mass | 350.11 |
| IUPAC Name | 5-(4-chlorophenoxy)-1-(4-fluorophenoxy)-3,3-dimethylpentan-2-one |
| SMILES | CC(C)(CCOc1ccc(Cl)cc1)C(=O)COc1ccc(F)cc1 |
| InChI | InChI=1S/C19H20ClFO3/c1-19(2,11-12-23-16-7-3-14(20)4-8-16)18(22)13-24-17-9-5-15(21)6-10-17/h3-10H,11-13H2,1-2H3 |
| InChIKey | QHRDYXHRPZIVKE-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.82 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |