C20H21ClO4 — CID 146593972
4-[4-[2-(4-chlorophenyl)acetyl]phenoxy]-2,2-dimethylbutanoic acid (PubChem CID 146593972) has the molecular formula C20H21ClO4 and a molecular weight of 360.84 g/mol. Its IUPAC name is 4-[4-[2-(4-chlorophenyl)acetyl]phenoxy]-2,2-dimethylbutanoic acid.
| Compound Name | 4-[4-[2-(4-chlorophenyl)acetyl]phenoxy]-2,2-dimethylbutanoic acid |
|---|---|
| PubChem CID | 146593972 |
| Molecular Formula | C20H21ClO4 |
| Molecular Weight | 360.84 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | 4-[4-[2-(4-chlorophenyl)acetyl]phenoxy]-2,2-dimethylbutanoic acid |
| SMILES | CC(C)(CCOc1ccc(C(=O)Cc2ccc(Cl)cc2)cc1)C(=O)O |
| InChI | InChI=1S/C20H21ClO4/c1-20(2,19(23)24)11-12-25-17-9-5-15(6-10-17)18(22)13-14-3-7-16(21)8-4-14/h3-10H,11-13H2,1-2H3,(H,23,24) |
| InChIKey | LOZAJXOLZCWRFQ-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.84 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |