C17H17ClO4 — CID 146594283
3-[4-(4-chlorophenoxy)phenoxy]-2,2-dimethylpropanoic acid (PubChem CID 146594283) has the molecular formula C17H17ClO4 and a molecular weight of 320.77 g/mol. Its IUPAC name is 3-[4-(4-chlorophenoxy)phenoxy]-2,2-dimethylpropanoic acid.
| Compound Name | 3-[4-(4-chlorophenoxy)phenoxy]-2,2-dimethylpropanoic acid |
|---|---|
| PubChem CID | 146594283 |
| Molecular Formula | C17H17ClO4 |
| Molecular Weight | 320.77 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | 3-[4-(4-chlorophenoxy)phenoxy]-2,2-dimethylpropanoic acid |
| SMILES | CC(C)(COc1ccc(Oc2ccc(Cl)cc2)cc1)C(=O)O |
| InChI | InChI=1S/C17H17ClO4/c1-17(2,16(19)20)11-21-13-7-9-15(10-8-13)22-14-5-3-12(18)4-6-14/h3-10H,11H2,1-2H3,(H,19,20) |
| InChIKey | LQBUZISBWXLSRD-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.77 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |