C22H19ClO4 — CID 10619958
3-(4-chlorophenyl)-2-methyl-2-(4-phenoxyphenoxy)propanoic acid (PubChem CID 10619958) has the molecular formula C22H19ClO4 and a molecular weight of 382.84 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-2-methyl-2-(4-phenoxyphenoxy)propanoic acid.
| Compound Name | 3-(4-chlorophenyl)-2-methyl-2-(4-phenoxyphenoxy)propanoic acid |
|---|---|
| PubChem CID | 10619958 |
| Molecular Formula | C22H19ClO4 |
| Molecular Weight | 382.84 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | 3-(4-chlorophenyl)-2-methyl-2-(4-phenoxyphenoxy)propanoic acid |
| SMILES | CC(Cc1ccc(Cl)cc1)(Oc1ccc(Oc2ccccc2)cc1)C(=O)O |
| InChI | InChI=1S/C22H19ClO4/c1-22(21(24)25,15-16-7-9-17(23)10-8-16)27-20-13-11-19(12-14-20)26-18-5-3-2-4-6-18/h2-14H,15H2,1H3,(H,24,25) |
| InChIKey | RGIPABCDYDVYTR-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.84 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |