C19H20ClNO4 — CID 70276943
5-benzamido-2-(4-chlorophenoxy)-2-methylpentanoic acid (PubChem CID 70276943) has the molecular formula C19H20ClNO4 and a molecular weight of 361.83 g/mol. Its IUPAC name is 5-benzamido-2-(4-chlorophenoxy)-2-methylpentanoic acid.
| Compound Name | 5-benzamido-2-(4-chlorophenoxy)-2-methylpentanoic acid |
|---|---|
| PubChem CID | 70276943 |
| Molecular Formula | C19H20ClNO4 |
| Molecular Weight | 361.83 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | 5-benzamido-2-(4-chlorophenoxy)-2-methylpentanoic acid |
| SMILES | CC(CCCNC(=O)c1ccccc1)(Oc1ccc(Cl)cc1)C(=O)O |
| InChI | InChI=1S/C19H20ClNO4/c1-19(18(23)24,25-16-10-8-15(20)9-11-16)12-5-13-21-17(22)14-6-3-2-4-7-14/h2-4,6-11H,5,12-13H2,1H3,(H,21,22)(H,23,24) |
| InChIKey | LXSWSZARPDBJSM-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.83 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|