C23H24Br6N2O4 — CID 21452884
4-(tribromomethoxy)-N-[7-[[4-(tribromomethoxy)benzoyl]amino]heptyl]benzamide (PubChem CID 21452884) has the molecular formula C23H24Br6N2O4 and a molecular weight of 871.88 g/mol. Its IUPAC name is 4-(tribromomethoxy)-N-[7-[[4-(tribromomethoxy)benzoyl]amino]heptyl]benzamide.
| Compound Name | 4-(tribromomethoxy)-N-[7-[[4-(tribromomethoxy)benzoyl]amino]heptyl]benzamide |
|---|---|
| PubChem CID | 21452884 |
| Molecular Formula | C23H24Br6N2O4 |
| Molecular Weight | 871.88 g/mol |
| Exact Mass | 865.68 |
| IUPAC Name | 4-(tribromomethoxy)-N-[7-[[4-(tribromomethoxy)benzoyl]amino]heptyl]benzamide |
| SMILES | O=C(NCCCCCCCNC(=O)c1ccc(OC(Br)(Br)Br)cc1)c1ccc(OC(Br)(Br)Br)cc1 |
| InChI | InChI=1S/C23H24Br6N2O4/c24-22(25,26)34-18-10-6-16(7-11-18)20(32)30-14-4-2-1-3-5-15-31-21(33)17-8-12-19(13-9-17)35-23(27,28)29/h6-13H,1-5,14-15H2,(H,30,32)(H,31,33) |
| InChIKey | GXACKHAIHADENA-UHFFFAOYSA-N |
| XLogP | 8.15 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 871.88 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|