C13H15F3INO2 — CID 107322364
N-(5-iodopentyl)-4-(trifluoromethoxy)benzamide (PubChem CID 107322364) has the molecular formula C13H15F3INO2 and a molecular weight of 401.17 g/mol. Its IUPAC name is N-(5-iodopentyl)-4-(trifluoromethoxy)benzamide.
| Compound Name | N-(5-iodopentyl)-4-(trifluoromethoxy)benzamide |
|---|---|
| PubChem CID | 107322364 |
| Molecular Formula | C13H15F3INO2 |
| Molecular Weight | 401.17 g/mol |
| Exact Mass | 401.01 |
| IUPAC Name | N-(5-iodopentyl)-4-(trifluoromethoxy)benzamide |
| SMILES | O=C(NCCCCCI)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C13H15F3INO2/c14-13(15,16)20-11-6-4-10(5-7-11)12(19)18-9-3-1-2-8-17/h4-7H,1-3,8-9H2,(H,18,19) |
| InChIKey | TUBKLFYTSFJSDU-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.17 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|