C25H28F6N2O4 — CID 21452931
N-[7-[ethyl-[4-(trifluoromethoxy)benzoyl]amino]heptyl]-4-(trifluoromethoxy)benzamide (PubChem CID 21452931) has the molecular formula C25H28F6N2O4 and a molecular weight of 534.50 g/mol. Its IUPAC name is N-[7-[ethyl-[4-(trifluoromethoxy)benzoyl]amino]heptyl]-4-(trifluoromethoxy)benzamide.
| Compound Name | N-[7-[ethyl-[4-(trifluoromethoxy)benzoyl]amino]heptyl]-4-(trifluoromethoxy)benzamide |
|---|---|
| PubChem CID | 21452931 |
| Molecular Formula | C25H28F6N2O4 |
| Molecular Weight | 534.50 g/mol |
| Exact Mass | 534.20 |
| IUPAC Name | N-[7-[ethyl-[4-(trifluoromethoxy)benzoyl]amino]heptyl]-4-(trifluoromethoxy)benzamide |
| SMILES | CCN(CCCCCCCNC(=O)c1ccc(OC(F)(F)F)cc1)C(=O)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C25H28F6N2O4/c1-2-33(23(35)19-10-14-21(15-11-19)37-25(29,30)31)17-7-5-3-4-6-16-32-22(34)18-8-12-20(13-9-18)36-24(26,27)28/h8-15H,2-7,16-17H2,1H3,(H,32,34) |
| InChIKey | MPQFKOBHONBJPW-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.50 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|