C22H24BrF3N2O3 — CID 54468916
N-[7-[(4-bromobenzoyl)amino]heptyl]-4-(trifluoromethoxy)benzamide (PubChem CID 54468916) has the molecular formula C22H24BrF3N2O3 and a molecular weight of 501.34 g/mol. Its IUPAC name is N-[7-[(4-bromobenzoyl)amino]heptyl]-4-(trifluoromethoxy)benzamide.
| Compound Name | N-[7-[(4-bromobenzoyl)amino]heptyl]-4-(trifluoromethoxy)benzamide |
|---|---|
| PubChem CID | 54468916 |
| Molecular Formula | C22H24BrF3N2O3 |
| Molecular Weight | 501.34 g/mol |
| Exact Mass | 500.09 |
| IUPAC Name | N-[7-[(4-bromobenzoyl)amino]heptyl]-4-(trifluoromethoxy)benzamide |
| SMILES | O=C(NCCCCCCCNC(=O)c1ccc(OC(F)(F)F)cc1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C22H24BrF3N2O3/c23-18-10-6-16(7-11-18)20(29)27-14-4-2-1-3-5-15-28-21(30)17-8-12-19(13-9-17)31-22(24,25)26/h6-13H,1-5,14-15H2,(H,27,29)(H,28,30) |
| InChIKey | XGXPNUQNZMIUSM-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.34 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|