C17H15ClF3NO4 — CID 174391022
N-[3-(3-chloro-4-hydroxyphenoxy)propyl]-4-(trifluoromethoxy)benzamide (PubChem CID 174391022) has the molecular formula C17H15ClF3NO4 and a molecular weight of 389.76 g/mol. Its IUPAC name is N-[3-(3-chloro-4-hydroxyphenoxy)propyl]-4-(trifluoromethoxy)benzamide.
| Compound Name | N-[3-(3-chloro-4-hydroxyphenoxy)propyl]-4-(trifluoromethoxy)benzamide |
|---|---|
| PubChem CID | 174391022 |
| Molecular Formula | C17H15ClF3NO4 |
| Molecular Weight | 389.76 g/mol |
| Exact Mass | 389.06 |
| IUPAC Name | N-[3-(3-chloro-4-hydroxyphenoxy)propyl]-4-(trifluoromethoxy)benzamide |
| SMILES | O=C(NCCCOc1ccc(O)c(Cl)c1)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C17H15ClF3NO4/c18-14-10-13(6-7-15(14)23)25-9-1-8-22-16(24)11-2-4-12(5-3-11)26-17(19,20)21/h2-7,10,23H,1,8-9H2,(H,22,24) |
| InChIKey | OVROQERDIOCUSL-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.76 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|