C17H16F3NO4 — CID 27823943
N-[2-(2-methoxyphenoxy)ethyl]-4-(trifluoromethoxy)benzamide (PubChem CID 27823943) has the molecular formula C17H16F3NO4 and a molecular weight of 355.31 g/mol. Its IUPAC name is N-[2-(2-methoxyphenoxy)ethyl]-4-(trifluoromethoxy)benzamide.
| Compound Name | N-[2-(2-methoxyphenoxy)ethyl]-4-(trifluoromethoxy)benzamide |
|---|---|
| PubChem CID | 27823943 |
| Molecular Formula | C17H16F3NO4 |
| Molecular Weight | 355.31 g/mol |
| Exact Mass | 355.10 |
| IUPAC Name | N-[2-(2-methoxyphenoxy)ethyl]-4-(trifluoromethoxy)benzamide |
| SMILES | COc1ccccc1OCCNC(=O)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C17H16F3NO4/c1-23-14-4-2-3-5-15(14)24-11-10-21-16(22)12-6-8-13(9-7-12)25-17(18,19)20/h2-9H,10-11H2,1H3,(H,21,22) |
| InChIKey | NEWMHVQURFFEDB-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.31 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|