C18H18F3NO5 — CID 41261622
4-(trifluoromethoxy)-N-[(3,4,5-trimethoxyphenyl)methyl]benzamide (PubChem CID 41261622) has the molecular formula C18H18F3NO5 and a molecular weight of 385.34 g/mol. Its IUPAC name is 4-(trifluoromethoxy)-N-[(3,4,5-trimethoxyphenyl)methyl]benzamide.
| Compound Name | 4-(trifluoromethoxy)-N-[(3,4,5-trimethoxyphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 41261622 |
| Molecular Formula | C18H18F3NO5 |
| Molecular Weight | 385.34 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | 4-(trifluoromethoxy)-N-[(3,4,5-trimethoxyphenyl)methyl]benzamide |
| SMILES | COc1cc(CNC(=O)c2ccc(OC(F)(F)F)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C18H18F3NO5/c1-24-14-8-11(9-15(25-2)16(14)26-3)10-22-17(23)12-4-6-13(7-5-12)27-18(19,20)21/h4-9H,10H2,1-3H3,(H,22,23) |
| InChIKey | ZEXIYZIJGJNORZ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.34 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |