C24H25NO4S — CID 31446452
4-(phenylsulfanylmethyl)-N-[(3,4,5-trimethoxyphenyl)methyl]benzamide (PubChem CID 31446452) has the molecular formula C24H25NO4S and a molecular weight of 423.53 g/mol. Its IUPAC name is 4-(phenylsulfanylmethyl)-N-[(3,4,5-trimethoxyphenyl)methyl]benzamide.
| Compound Name | 4-(phenylsulfanylmethyl)-N-[(3,4,5-trimethoxyphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 31446452 |
| Molecular Formula | C24H25NO4S |
| Molecular Weight | 423.53 g/mol |
| Exact Mass | 423.15 |
| IUPAC Name | 4-(phenylsulfanylmethyl)-N-[(3,4,5-trimethoxyphenyl)methyl]benzamide |
| SMILES | COc1cc(CNC(=O)c2ccc(CSc3ccccc3)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C24H25NO4S/c1-27-21-13-18(14-22(28-2)23(21)29-3)15-25-24(26)19-11-9-17(10-12-19)16-30-20-7-5-4-6-8-20/h4-14H,15-16H2,1-3H3,(H,25,26) |
| InChIKey | MQMNJGDENYQWLZ-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.53 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |