C23H23NO3S — CID 173203978
N-[(2,6-dimethoxyphenyl)methyl]-3-(phenylsulfanylmethyl)benzamide (PubChem CID 173203978) has the molecular formula C23H23NO3S and a molecular weight of 393.51 g/mol. Its IUPAC name is N-[(2,6-dimethoxyphenyl)methyl]-3-(phenylsulfanylmethyl)benzamide.
| Compound Name | N-[(2,6-dimethoxyphenyl)methyl]-3-(phenylsulfanylmethyl)benzamide |
|---|---|
| PubChem CID | 173203978 |
| Molecular Formula | C23H23NO3S |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | N-[(2,6-dimethoxyphenyl)methyl]-3-(phenylsulfanylmethyl)benzamide |
| SMILES | COc1cccc(OC)c1CNC(=O)c1cccc(CSc2ccccc2)c1 |
| InChI | InChI=1S/C23H23NO3S/c1-26-21-12-7-13-22(27-2)20(21)15-24-23(25)18-9-6-8-17(14-18)16-28-19-10-4-3-5-11-19/h3-14H,15-16H2,1-2H3,(H,24,25) |
| InChIKey | JQDSMSKVRMOINA-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |