C15H13ClINO2 — CID 103292680
N-[(2-chloro-6-methoxyphenyl)methyl]-3-iodobenzamide (PubChem CID 103292680) has the molecular formula C15H13ClINO2 and a molecular weight of 401.63 g/mol. Its IUPAC name is N-[(2-chloro-6-methoxyphenyl)methyl]-3-iodobenzamide.
| Compound Name | N-[(2-chloro-6-methoxyphenyl)methyl]-3-iodobenzamide |
|---|---|
| PubChem CID | 103292680 |
| Molecular Formula | C15H13ClINO2 |
| Molecular Weight | 401.63 g/mol |
| Exact Mass | 400.97 |
| IUPAC Name | N-[(2-chloro-6-methoxyphenyl)methyl]-3-iodobenzamide |
| SMILES | COc1cccc(Cl)c1CNC(=O)c1cccc(I)c1 |
| InChI | InChI=1S/C15H13ClINO2/c1-20-14-7-3-6-13(16)12(14)9-18-15(19)10-4-2-5-11(17)8-10/h2-8H,9H2,1H3,(H,18,19) |
| InChIKey | DRUHRTNCUKFJGF-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.63 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|